C27H40NO+ — CID 7329365
(2S,3R,4R,6S)-4-butyl-1-methyl-3-pentyl-2,6-diphenylpiperidin-1-ium-4-ol (PubChem CID 7329365) has the molecular formula C27H40NO+ and a molecular weight of 394.62 g/mol. Its IUPAC name is (2S,3R,4R,6S)-4-butyl-1-methyl-3-pentyl-2,6-diphenylpiperidin-1-ium-4-ol.
| Compound Name | (2S,3R,4R,6S)-4-butyl-1-methyl-3-pentyl-2,6-diphenylpiperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 7329365 |
| Molecular Formula | C27H40NO+ |
| Molecular Weight | 394.62 g/mol |
| Exact Mass | 394.31 |
| IUPAC Name | (2S,3R,4R,6S)-4-butyl-1-methyl-3-pentyl-2,6-diphenylpiperidin-1-ium-4-ol |
| SMILES | CCCCC[C@@H]1[C@@H](c2ccccc2)[NH+](C)[C@H](c2ccccc2)C[C@]1(O)CCCC |
| InChI | InChI=1S/C27H39NO/c1-4-6-10-19-24-26(23-17-13-9-14-18-23)28(3)25(22-15-11-8-12-16-22)21-27(24,29)20-7-5-2/h8-9,11-18,24-26,29H,4-7,10,19-21H2,1-3H3/p+1/t24-,25+,26-,27-/m1/s1 |
| InChIKey | WEOCXFUEIUWOBH-HVWQDESWSA-O |
| XLogP | 5.51 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.62 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|