C15H30O — CID 14921306
cis-(1S,2S)-1,2-dihexylcyclopropan-1-ol (PubChem CID 14921306) has the molecular formula C15H30O and a molecular weight of 226.40 g/mol. Its IUPAC name is cis-(1S,2S)-1,2-dihexylcyclopropan-1-ol.
| Compound Name | cis-(1S,2S)-1,2-dihexylcyclopropan-1-ol |
|---|---|
| PubChem CID | 14921306 |
| Molecular Formula | C15H30O |
| Molecular Weight | 226.40 g/mol |
| Exact Mass | 226.23 |
| IUPAC Name | cis-(1S,2S)-1,2-dihexylcyclopropan-1-ol |
| SMILES | CCCCCC[C@H]1C[C@@]1(O)CCCCCC |
| InChI | InChI=1S/C15H30O/c1-3-5-7-9-11-14-13-15(14,16)12-10-8-6-4-2/h14,16H,3-13H2,1-2H3/t14-,15-/m0/s1 |
| InChIKey | ICNQPBPXEYKVQX-GJZGRUSLSA-N |
| XLogP | 4.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.40 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|