C11H22O2 — CID 102019528
cis-(1R,2S)-1-ethoxy-2-hexylcyclopropan-1-ol (PubChem CID 102019528) has the molecular formula C11H22O2 and a molecular weight of 186.29 g/mol. Its IUPAC name is cis-(1R,2S)-1-ethoxy-2-hexylcyclopropan-1-ol.
| Compound Name | cis-(1R,2S)-1-ethoxy-2-hexylcyclopropan-1-ol |
|---|---|
| PubChem CID | 102019528 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | cis-(1R,2S)-1-ethoxy-2-hexylcyclopropan-1-ol |
| SMILES | CCCCCC[C@H]1C[C@@]1(O)OCC |
| InChI | InChI=1S/C11H22O2/c1-3-5-6-7-8-10-9-11(10,12)13-4-2/h10,12H,3-9H2,1-2H3/t10-,11+/m0/s1 |
| InChIKey | ZEYLWKKRGXLIMP-WDEREUQCSA-N |
| XLogP | 2.70 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|