C22H29NO — CID 1230070
(2R,3S,4R,6R)-3-ethyl-2,6-diphenyl-4-propylpiperidin-4-ol (PubChem CID 1230070) has the molecular formula C22H29NO and a molecular weight of 323.48 g/mol. Its IUPAC name is (2R,3S,4R,6R)-3-ethyl-2,6-diphenyl-4-propylpiperidin-4-ol.
| Compound Name | (2R,3S,4R,6R)-3-ethyl-2,6-diphenyl-4-propylpiperidin-4-ol |
|---|---|
| PubChem CID | 1230070 |
| Molecular Formula | C22H29NO |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | (2R,3S,4R,6R)-3-ethyl-2,6-diphenyl-4-propylpiperidin-4-ol |
| SMILES | CCC[C@@]1(O)C[C@H](c2ccccc2)N[C@@H](c2ccccc2)[C@@H]1CC |
| InChI | InChI=1S/C22H29NO/c1-3-15-22(24)16-20(17-11-7-5-8-12-17)23-21(19(22)4-2)18-13-9-6-10-14-18/h5-14,19-21,23-24H,3-4,15-16H2,1-2H3/t19-,20+,21-,22+/m0/s1 |
| InChIKey | PKBJXKBRDPQZEK-LNRXMEIDSA-N |
| XLogP | 5.02 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |