C26H29NO2 — CID 7392932
(2S,3S,4R,6S)-3-ethyl-4-(2-methoxyphenyl)-2,6-diphenylpiperidin-4-ol (PubChem CID 7392932) has the molecular formula C26H29NO2 and a molecular weight of 387.52 g/mol. Its IUPAC name is (2S,3S,4R,6S)-3-ethyl-4-(2-methoxyphenyl)-2,6-diphenylpiperidin-4-ol.
| Compound Name | (2S,3S,4R,6S)-3-ethyl-4-(2-methoxyphenyl)-2,6-diphenylpiperidin-4-ol |
|---|---|
| PubChem CID | 7392932 |
| Molecular Formula | C26H29NO2 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | (2S,3S,4R,6S)-3-ethyl-4-(2-methoxyphenyl)-2,6-diphenylpiperidin-4-ol |
| SMILES | CC[C@H]1[C@@H](c2ccccc2)N[C@H](c2ccccc2)C[C@]1(O)c1ccccc1OC |
| InChI | InChI=1S/C26H29NO2/c1-3-21-25(20-14-8-5-9-15-20)27-23(19-12-6-4-7-13-19)18-26(21,28)22-16-10-11-17-24(22)29-2/h4-17,21,23,25,27-28H,3,18H2,1-2H3/t21-,23-,25+,26+/m0/s1 |
| InChIKey | HKJVXAYMDUGIOW-AAOIWRJWSA-N |
| XLogP | 5.38 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |