C30H33NO3 — CID 41031072
(2R,3S,4R,6S)-2,6-bis(4-methoxyphenyl)-4-(2-phenylethynyl)-3-propylpiperidin-4-ol (PubChem CID 41031072) has the molecular formula C30H33NO3 and a molecular weight of 455.60 g/mol. Its IUPAC name is (2R,3S,4R,6S)-2,6-bis(4-methoxyphenyl)-4-(2-phenylethynyl)-3-propylpiperidin-4-ol.
| Compound Name | (2R,3S,4R,6S)-2,6-bis(4-methoxyphenyl)-4-(2-phenylethynyl)-3-propylpiperidin-4-ol |
|---|---|
| PubChem CID | 41031072 |
| Molecular Formula | C30H33NO3 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | (2R,3S,4R,6S)-2,6-bis(4-methoxyphenyl)-4-(2-phenylethynyl)-3-propylpiperidin-4-ol |
| SMILES | CCC[C@H]1[C@H](c2ccc(OC)cc2)N[C@H](c2ccc(OC)cc2)C[C@]1(O)C#Cc1ccccc1 |
| InChI | InChI=1S/C30H33NO3/c1-4-8-27-29(24-13-17-26(34-3)18-14-24)31-28(23-11-15-25(33-2)16-12-23)21-30(27,32)20-19-22-9-6-5-7-10-22/h5-7,9-18,27-29,31-32H,4,8,21H2,1-3H3/t27-,28-,29-,30+/m0/s1 |
| InChIKey | BKJQDSATKUPWJM-GCXHJFECSA-N |
| XLogP | 5.68 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|