C28H30ClNO3 — CID 44658150
2,6-bis(4-methoxyphenyl)-3-methyl-4-(2-phenylethynyl)piperidin-1-ium-4-ol chloride (PubChem CID 44658150) has the molecular formula C28H30ClNO3 and a molecular weight of 464.01 g/mol. Its IUPAC name is 2,6-bis(4-methoxyphenyl)-3-methyl-4-(2-phenylethynyl)piperidin-1-ium-4-ol chloride.
| Compound Name | 2,6-bis(4-methoxyphenyl)-3-methyl-4-(2-phenylethynyl)piperidin-1-ium-4-ol chloride |
|---|---|
| PubChem CID | 44658150 |
| Molecular Formula | C28H30ClNO3 |
| Molecular Weight | 464.01 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 2,6-bis(4-methoxyphenyl)-3-methyl-4-(2-phenylethynyl)piperidin-1-ium-4-ol chloride |
| SMILES | COc1ccc(C2CC(O)(C#Cc3ccccc3)C(C)C(c3ccc(OC)cc3)[NH2+]2)cc1.[Cl-] |
| InChI | InChI=1S/C28H29NO3.ClH/c1-20-27(23-11-15-25(32-3)16-12-23)29-26(22-9-13-24(31-2)14-10-22)19-28(20,30)18-17-21-7-5-4-6-8-21;/h4-16,20,26-27,29-30H,19H2,1-3H3;1H |
| InChIKey | ZUTJQDQWJJVWPD-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 55.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.01 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|