C19H26O2 — CID 10850785
(1S,2S,5R)-1-[2-(3-methoxyphenyl)ethynyl]-5-methyl-2-propan-2-ylcyclohexan-1-ol (PubChem CID 10850785) has the molecular formula C19H26O2 and a molecular weight of 286.42 g/mol. Its IUPAC name is (1S,2S,5R)-1-[2-(3-methoxyphenyl)ethynyl]-5-methyl-2-propan-2-ylcyclohexan-1-ol.
| Compound Name | (1S,2S,5R)-1-[2-(3-methoxyphenyl)ethynyl]-5-methyl-2-propan-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 10850785 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | (1S,2S,5R)-1-[2-(3-methoxyphenyl)ethynyl]-5-methyl-2-propan-2-ylcyclohexan-1-ol |
| SMILES | COc1cccc(C#C[C@]2(O)C[C@H](C)CC[C@H]2C(C)C)c1 |
| InChI | InChI=1S/C19H26O2/c1-14(2)18-9-8-15(3)13-19(18,20)11-10-16-6-5-7-17(12-16)21-4/h5-7,12,14-15,18,20H,8-9,13H2,1-4H3/t15-,18+,19+/m1/s1 |
| InChIKey | UHXQPDQKMCZGDS-MNEFBYGVSA-N |
| XLogP | 3.87 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|