C17H25ClO — CID 60798187
1-[(3-chlorophenyl)methyl]-5-methyl-2-propan-2-ylcyclohexan-1-ol (PubChem CID 60798187) has the molecular formula C17H25ClO and a molecular weight of 280.84 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-5-methyl-2-propan-2-ylcyclohexan-1-ol.
| Compound Name | 1-[(3-chlorophenyl)methyl]-5-methyl-2-propan-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 60798187 |
| Molecular Formula | C17H25ClO |
| Molecular Weight | 280.84 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-5-methyl-2-propan-2-ylcyclohexan-1-ol |
| SMILES | CC1CCC(C(C)C)C(O)(Cc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C17H25ClO/c1-12(2)16-8-7-13(3)10-17(16,19)11-14-5-4-6-15(18)9-14/h4-6,9,12-13,16,19H,7-8,10-11H2,1-3H3 |
| InChIKey | GGBXPAZFPFSVBY-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.84 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |