C17H26ClN — CID 107430001
1-[(3-chlorophenyl)methyl]-3-(2-methylpropyl)cyclohexan-1-amine (PubChem CID 107430001) has the molecular formula C17H26ClN and a molecular weight of 279.85 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-3-(2-methylpropyl)cyclohexan-1-amine.
| Compound Name | 1-[(3-chlorophenyl)methyl]-3-(2-methylpropyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 107430001 |
| Molecular Formula | C17H26ClN |
| Molecular Weight | 279.85 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-3-(2-methylpropyl)cyclohexan-1-amine |
| SMILES | CC(C)CC1CCCC(N)(Cc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C17H26ClN/c1-13(2)9-14-6-4-8-17(19,11-14)12-15-5-3-7-16(18)10-15/h3,5,7,10,13-14H,4,6,8-9,11-12,19H2,1-2H3 |
| InChIKey | PYJYRPSZIYYSJY-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.85 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |