About 1-[(3,5-difluorophenyl)methyl]-3-(2-methylpropyl)cyclohexan-1-amine
1-[(3,5-difluorophenyl)methyl]-3-(2-methylpropyl)cyclohexan-1-amine (PubChem CID 107430049) has the molecular formula C17H25F2N
and a molecular weight of 281.39 g/mol. Its IUPAC name is 1-[(3,5-difluorophenyl)methyl]-3-(2-methylpropyl)cyclohexan-1-amine.
Molecular Properties
| Compound Name | 1-[(3,5-difluorophenyl)methyl]-3-(2-methylpropyl)cyclohexan-1-amine |
| PubChem CID | 107430049 |
| Molecular Formula | C17H25F2N |
| Molecular Weight | 281.39 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 1-[(3,5-difluorophenyl)methyl]-3-(2-methylpropyl)cyclohexan-1-amine |
| SMILES | CC(C)CC1CCCC(N)(Cc2cc(F)cc(F)c2)C1 |
| InChI | InChI=1S/C17H25F2N/c1-12(2)6-13-4-3-5-17(20,10-13)11-14-7-15(18)9-16(19)8-14/h7-9,12-13H,3-6,10-11,20H2,1-2H3 |
| InChIKey | CPCZNLHKXGQCMQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.39 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[(3,5-difluorophenyl)methyl]-3-(2-methylpropyl)cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,5-difluorophenyl)methyl]-3-(2-methylpropyl)cyclohexan-1-amine?
The IUPAC name of 1-[(3,5-difluorophenyl)methyl]-3-(2-methylpropyl)cyclohexan-1-amine (CID 107430049) is 1-[(3,5-difluorophenyl)methyl]-3-(2-methylpropyl)cyclohexan-1-amine.
What is the SMILES notation for 1-[(3,5-difluorophenyl)methyl]-3-(2-methylpropyl)cyclohexan-1-amine?
The canonical SMILES for 1-[(3,5-difluorophenyl)methyl]-3-(2-methylpropyl)cyclohexan-1-amine is CC(C)CC1CCCC(N)(Cc2cc(F)cc(F)c2)C1.
What is the InChIKey of 1-[(3,5-difluorophenyl)methyl]-3-(2-methylpropyl)cyclohexan-1-amine?
The InChIKey is CPCZNLHKXGQCMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25F2N/c1-12(2)6-13-4-3-5-17(20,10-13)11-14-7-15(18)9-16(19)8-14/h7-9,12-13H,3-6,10-11,20H2,1-2H3.
What are the key properties of 1-[(3,5-difluorophenyl)methyl]-3-(2-methylpropyl)cyclohexan-1-amine?
1-[(3,5-difluorophenyl)methyl]-3-(2-methylpropyl)cyclohexan-1-amine has a molecular weight of 281.39 g/mol, XLogP of 4.44, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,5-difluorophenyl)methyl]-3-(2-methylpropyl)cyclohexan-1-amine is sourced from PubChem (CID 107430049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).