C18H26Cl2O3S — CID 102523112
(1S,2S,5R)-1-[dichloro-(4-methoxyphenyl)sulfinylmethyl]-5-methyl-2-propan-2-ylcyclohexan-1-ol (PubChem CID 102523112) has the molecular formula C18H26Cl2O3S and a molecular weight of 393.38 g/mol. Its IUPAC name is (1S,2S,5R)-1-[dichloro-(4-methoxyphenyl)sulfinylmethyl]-5-methyl-2-propan-2-ylcyclohexan-1-ol.
| Compound Name | (1S,2S,5R)-1-[dichloro-(4-methoxyphenyl)sulfinylmethyl]-5-methyl-2-propan-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 102523112 |
| Molecular Formula | C18H26Cl2O3S |
| Molecular Weight | 393.38 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | (1S,2S,5R)-1-[dichloro-(4-methoxyphenyl)sulfinylmethyl]-5-methyl-2-propan-2-ylcyclohexan-1-ol |
| SMILES | COc1ccc(S(=O)C(Cl)(Cl)[C@]2(O)C[C@H](C)CC[C@H]2C(C)C)cc1 |
| InChI | InChI=1S/C18H26Cl2O3S/c1-12(2)16-10-5-13(3)11-17(16,21)18(19,20)24(22)15-8-6-14(23-4)7-9-15/h6-9,12-13,16,21H,5,10-11H2,1-4H3/t13-,16+,17+,24?/m1/s1 |
| InChIKey | TXOPFTNLCXEHPZ-UFRWLJJJSA-N |
| XLogP | 4.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.38 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|