C28H30NO+ — CID 7392919
(2R,3S,4R,6S)-2,6-diphenyl-4-(2-phenylethynyl)-3-propan-2-ylpiperidin-1-ium-4-ol (PubChem CID 7392919) has the molecular formula C28H30NO+ and a molecular weight of 396.55 g/mol. Its IUPAC name is (2R,3S,4R,6S)-2,6-diphenyl-4-(2-phenylethynyl)-3-propan-2-ylpiperidin-1-ium-4-ol.
| Compound Name | (2R,3S,4R,6S)-2,6-diphenyl-4-(2-phenylethynyl)-3-propan-2-ylpiperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 7392919 |
| Molecular Formula | C28H30NO+ |
| Molecular Weight | 396.55 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | (2R,3S,4R,6S)-2,6-diphenyl-4-(2-phenylethynyl)-3-propan-2-ylpiperidin-1-ium-4-ol |
| SMILES | CC(C)[C@H]1[C@H](c2ccccc2)[NH2+][C@H](c2ccccc2)C[C@]1(O)C#Cc1ccccc1 |
| InChI | InChI=1S/C28H29NO/c1-21(2)26-27(24-16-10-5-11-17-24)29-25(23-14-8-4-9-15-23)20-28(26,30)19-18-22-12-6-3-7-13-22/h3-17,21,25-27,29-30H,20H2,1-2H3/p+1/t25-,26-,27-,28+/m0/s1 |
| InChIKey | YXGCKQSCISYXIL-LAJGZZDBSA-O |
| XLogP | 4.49 |
| TPSA | 36.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|