C15H16O — CID 102212474
(1S,4R)-2-(2-phenylethynyl)bicyclo[2.2.1]heptan-2-ol (PubChem CID 102212474) has the molecular formula C15H16O and a molecular weight of 212.29 g/mol. Its IUPAC name is (1S,4R)-2-(2-phenylethynyl)bicyclo[2.2.1]heptan-2-ol.
| Compound Name | (1S,4R)-2-(2-phenylethynyl)bicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 102212474 |
| Molecular Formula | C15H16O |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | (1S,4R)-2-(2-phenylethynyl)bicyclo[2.2.1]heptan-2-ol |
| SMILES | OC1(C#Cc2ccccc2)C[C@@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C15H16O/c16-15(11-13-6-7-14(15)10-13)9-8-12-4-2-1-3-5-12/h1-5,13-14,16H,6-7,10-11H2/t13-,14+,15?/m1/s1 |
| InChIKey | BTOFJIFLKXIONB-GNXJLENFSA-N |
| XLogP | 2.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|