C14H16O — CID 101375058
trans-(1R,2R)-2-methyl-1-(2-phenylethynyl)cyclopentan-1-ol (PubChem CID 101375058) has the molecular formula C14H16O and a molecular weight of 200.28 g/mol. Its IUPAC name is trans-(1R,2R)-2-methyl-1-(2-phenylethynyl)cyclopentan-1-ol.
| Compound Name | trans-(1R,2R)-2-methyl-1-(2-phenylethynyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 101375058 |
| Molecular Formula | C14H16O |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | trans-(1R,2R)-2-methyl-1-(2-phenylethynyl)cyclopentan-1-ol |
| SMILES | C[C@@H]1CCC[C@]1(O)C#Cc1ccccc1 |
| InChI | InChI=1S/C14H16O/c1-12-6-5-10-14(12,15)11-9-13-7-3-2-4-8-13/h2-4,7-8,12,15H,5-6,10H2,1H3/t12-,14+/m1/s1 |
| InChIKey | DXRMLMZKGWTYSH-OCCSQVGLSA-N |
| XLogP | 2.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|