C17H24OSi — CID 134942107
trimethyl-[(1R,2R)-2-methyl-1-(2-phenylethynyl)cyclopentyl]oxysilane (PubChem CID 134942107) has the molecular formula C17H24OSi and a molecular weight of 272.46 g/mol. Its IUPAC name is trimethyl-[(1R,2R)-2-methyl-1-(2-phenylethynyl)cyclopentyl]oxysilane.
| Compound Name | trimethyl-[(1R,2R)-2-methyl-1-(2-phenylethynyl)cyclopentyl]oxysilane |
|---|---|
| PubChem CID | 134942107 |
| Molecular Formula | C17H24OSi |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | trimethyl-[(1R,2R)-2-methyl-1-(2-phenylethynyl)cyclopentyl]oxysilane |
| SMILES | C[C@@H]1CCC[C@@]1(C#Cc1ccccc1)O[Si](C)(C)C |
| InChI | InChI=1S/C17H24OSi/c1-15-9-8-13-17(15,18-19(2,3)4)14-12-16-10-6-5-7-11-16/h5-7,10-11,15H,8-9,13H2,1-4H3/t15-,17+/m1/s1 |
| InChIKey | MANJBJCKOMVWHX-WBVHZDCISA-N |
| XLogP | 4.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|