C19H24O2Si — CID 134922183
(1S,6R)-8-(2-phenylethynyl)-8-trimethylsilyloxybicyclo[4.2.0]octan-7-one (PubChem CID 134922183) has the molecular formula C19H24O2Si and a molecular weight of 312.48 g/mol. Its IUPAC name is (1S,6R)-8-(2-phenylethynyl)-8-trimethylsilyloxybicyclo[4.2.0]octan-7-one.
| Compound Name | (1S,6R)-8-(2-phenylethynyl)-8-trimethylsilyloxybicyclo[4.2.0]octan-7-one |
|---|---|
| PubChem CID | 134922183 |
| Molecular Formula | C19H24O2Si |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | (1S,6R)-8-(2-phenylethynyl)-8-trimethylsilyloxybicyclo[4.2.0]octan-7-one |
| SMILES | C[Si](C)(C)OC1(C#Cc2ccccc2)C(=O)[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C19H24O2Si/c1-22(2,3)21-19(14-13-15-9-5-4-6-10-15)17-12-8-7-11-16(17)18(19)20/h4-6,9-10,16-17H,7-8,11-12H2,1-3H3/t16-,17+,19?/m1/s1 |
| InChIKey | WXGKBJNVIFCPGH-FQZXCLDYSA-N |
| XLogP | 4.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|