C22H30O3Si — CID 134983521
trimethyl-[4-methylidene-1-(2-phenylethynyl)-2,3-di(propan-2-yloxy)cyclobut-2-en-1-yl]oxysilane (PubChem CID 134983521) has the molecular formula C22H30O3Si and a molecular weight of 370.57 g/mol. Its IUPAC name is trimethyl-[4-methylidene-1-(2-phenylethynyl)-2,3-di(propan-2-yloxy)cyclobut-2-en-1-yl]oxysilane.
| Compound Name | trimethyl-[4-methylidene-1-(2-phenylethynyl)-2,3-di(propan-2-yloxy)cyclobut-2-en-1-yl]oxysilane |
|---|---|
| PubChem CID | 134983521 |
| Molecular Formula | C22H30O3Si |
| Molecular Weight | 370.57 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | trimethyl-[4-methylidene-1-(2-phenylethynyl)-2,3-di(propan-2-yloxy)cyclobut-2-en-1-yl]oxysilane |
| SMILES | C=C1C(OC(C)C)=C(OC(C)C)C1(C#Cc1ccccc1)O[Si](C)(C)C |
| InChI | InChI=1S/C22H30O3Si/c1-16(2)23-20-18(5)22(25-26(6,7)8,21(20)24-17(3)4)15-14-19-12-10-9-11-13-19/h9-13,16-17H,5H2,1-4,6-8H3 |
| InChIKey | JWVRZCRXSKWTQW-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.57 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|