C19H20OSi — CID 99863917
trimethyl-[[(7S)-7-(2-phenylethynyl)-7-bicyclo[4.2.0]octa-1,3,5-trienyl]oxy]silane (PubChem CID 99863917) has the molecular formula C19H20OSi and a molecular weight of 292.45 g/mol. Its IUPAC name is trimethyl-[[(7S)-7-(2-phenylethynyl)-7-bicyclo[4.2.0]octa-1,3,5-trienyl]oxy]silane.
| Compound Name | trimethyl-[[(7S)-7-(2-phenylethynyl)-7-bicyclo[4.2.0]octa-1,3,5-trienyl]oxy]silane |
|---|---|
| PubChem CID | 99863917 |
| Molecular Formula | C19H20OSi |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | trimethyl-[[(7S)-7-(2-phenylethynyl)-7-bicyclo[4.2.0]octa-1,3,5-trienyl]oxy]silane |
| SMILES | C[Si](C)(C)O[C@]1(C#Cc2ccccc2)Cc2ccccc21 |
| InChI | InChI=1S/C19H20OSi/c1-21(2,3)20-19(14-13-16-9-5-4-6-10-16)15-17-11-7-8-12-18(17)19/h4-12H,15H2,1-3H3/t19-/m1/s1 |
| InChIKey | GRRJZOSVIBMDQU-LJQANCHMSA-N |
| XLogP | 4.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|