C18H20O2Si — CID 100988181
phenyl-[(7S)-7-trimethylsilyloxy-7-bicyclo[4.2.0]octa-1,3,5-trienyl]methanone (PubChem CID 100988181) has the molecular formula C18H20O2Si and a molecular weight of 296.44 g/mol. Its IUPAC name is phenyl-[(7S)-7-trimethylsilyloxy-7-bicyclo[4.2.0]octa-1,3,5-trienyl]methanone.
| Compound Name | phenyl-[(7S)-7-trimethylsilyloxy-7-bicyclo[4.2.0]octa-1,3,5-trienyl]methanone |
|---|---|
| PubChem CID | 100988181 |
| Molecular Formula | C18H20O2Si |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | phenyl-[(7S)-7-trimethylsilyloxy-7-bicyclo[4.2.0]octa-1,3,5-trienyl]methanone |
| SMILES | C[Si](C)(C)O[C@@]1(C(=O)c2ccccc2)Cc2ccccc21 |
| InChI | InChI=1S/C18H20O2Si/c1-21(2,3)20-18(13-15-11-7-8-12-16(15)18)17(19)14-9-5-4-6-10-14/h4-12H,13H2,1-3H3/t18-/m0/s1 |
| InChIKey | JVOPNFXJYIOZBH-SFHVURJKSA-N |
| XLogP | 4.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|