C19H22O2Si — CID 99863928
1-phenyl-2-[(7S)-7-trimethylsilyloxy-7-bicyclo[4.2.0]octa-1,3,5-trienyl]ethanone (PubChem CID 99863928) has the molecular formula C19H22O2Si and a molecular weight of 310.47 g/mol. Its IUPAC name is 1-phenyl-2-[(7S)-7-trimethylsilyloxy-7-bicyclo[4.2.0]octa-1,3,5-trienyl]ethanone.
| Compound Name | 1-phenyl-2-[(7S)-7-trimethylsilyloxy-7-bicyclo[4.2.0]octa-1,3,5-trienyl]ethanone |
|---|---|
| PubChem CID | 99863928 |
| Molecular Formula | C19H22O2Si |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 1-phenyl-2-[(7S)-7-trimethylsilyloxy-7-bicyclo[4.2.0]octa-1,3,5-trienyl]ethanone |
| SMILES | C[Si](C)(C)O[C@]1(CC(=O)c2ccccc2)Cc2ccccc21 |
| InChI | InChI=1S/C19H22O2Si/c1-22(2,3)21-19(13-16-11-7-8-12-17(16)19)14-18(20)15-9-5-4-6-10-15/h4-12H,13-14H2,1-3H3/t19-/m0/s1 |
| InChIKey | MQWFSVPRZFRROK-IBGZPJMESA-N |
| XLogP | 4.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|