C15H20O3 — CID 14491690
2-(2-tert-butyl-1,3-dioxolan-2-yl)-1-phenylethanone (PubChem CID 14491690) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is 2-(2-tert-butyl-1,3-dioxolan-2-yl)-1-phenylethanone.
| Compound Name | 2-(2-tert-butyl-1,3-dioxolan-2-yl)-1-phenylethanone |
|---|---|
| PubChem CID | 14491690 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 2-(2-tert-butyl-1,3-dioxolan-2-yl)-1-phenylethanone |
| SMILES | CC(C)(C)C1(CC(=O)c2ccccc2)OCCO1 |
| InChI | InChI=1S/C15H20O3/c1-14(2,3)15(17-9-10-18-15)11-13(16)12-7-5-4-6-8-12/h4-8H,9-11H2,1-3H3 |
| InChIKey | BNCFWZCBHYQZSF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |