C13H18O4 — CID 175131746
1,3-dioxolan-2-ylmethanol;1-phenylpropan-1-one (PubChem CID 175131746) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is 1,3-dioxolan-2-ylmethanol;1-phenylpropan-1-one.
| Compound Name | 1,3-dioxolan-2-ylmethanol;1-phenylpropan-1-one |
|---|---|
| PubChem CID | 175131746 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 1,3-dioxolan-2-ylmethanol;1-phenylpropan-1-one |
| SMILES | CCC(=O)c1ccccc1.OCC1OCCO1 |
| InChI | InChI=1S/C9H10O.C4H8O3/c1-2-9(10)8-6-4-3-5-7-8;5-3-4-6-1-2-7-4/h3-7H,2H2,1H3;4-5H,1-3H2 |
| InChIKey | JYZFSMVDXUMIHG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |