(7R)-7-benzylbicyclo[4.2.0]octa-1,3,5-triene-7-carboxylic acid

C16H14O2 — CID 125469336

IUPAC(7R)-7-benzylbicyclo[4.2.0]octa-1,3,5-triene-7-carboxylic acid
SMILESO=C(O)[C@]1(Cc2ccccc2)Cc2ccccc21
InChIInChI=1S/C16H14O2/c17-15(18)16(10-12-6-2-1-3-7-12)11-13-8-4-5-9-14(13)16/h1-9H,10-11H2,(H,17,18)/t16-/m1/s1
InChIKeyCKTGCBKGJZUYCV-MRXNPFEDSA-N
MW238.29 g/mol
LogP2.81
Rot. Bonds3

About (7R)-7-benzylbicyclo[4.2.0]octa-1,3,5-triene-7-carboxylic acid

(7R)-7-benzylbicyclo[4.2.0]octa-1,3,5-triene-7-carboxylic acid (PubChem CID 125469336) has the molecular formula C16H14O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is (7R)-7-benzylbicyclo[4.2.0]octa-1,3,5-triene-7-carboxylic acid.

Molecular Properties

Compound Name(7R)-7-benzylbicyclo[4.2.0]octa-1,3,5-triene-7-carboxylic acid
PubChem CID125469336
Molecular FormulaC16H14O2
Molecular Weight238.29 g/mol
Exact Mass238.10
IUPAC Name(7R)-7-benzylbicyclo[4.2.0]octa-1,3,5-triene-7-carboxylic acid
SMILESO=C(O)[C@]1(Cc2ccccc2)Cc2ccccc21
InChIInChI=1S/C16H14O2/c17-15(18)16(10-12-6-2-1-3-7-12)11-13-8-4-5-9-14(13)16/h1-9H,10-11H2,(H,17,18)/t16-/m1/s1
InChIKeyCKTGCBKGJZUYCV-MRXNPFEDSA-N
XLogP2.81
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.29
LogP ≤ 52.81
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze (7R)-7-benzylbicyclo[4.2.0]octa-1,3,5-triene-7-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (7R)-7-benzylbicyclo[4.2.0]octa-1,3,5-triene-7-carboxylic acid?
The IUPAC name of (7R)-7-benzylbicyclo[4.2.0]octa-1,3,5-triene-7-carboxylic acid (CID 125469336) is (7R)-7-benzylbicyclo[4.2.0]octa-1,3,5-triene-7-carboxylic acid.
What is the SMILES notation for (7R)-7-benzylbicyclo[4.2.0]octa-1,3,5-triene-7-carboxylic acid?
The canonical SMILES for (7R)-7-benzylbicyclo[4.2.0]octa-1,3,5-triene-7-carboxylic acid is O=C(O)[C@]1(Cc2ccccc2)Cc2ccccc21.
What is the InChIKey of (7R)-7-benzylbicyclo[4.2.0]octa-1,3,5-triene-7-carboxylic acid?
The InChIKey is CKTGCBKGJZUYCV-MRXNPFEDSA-N. The full InChI is InChI=1S/C16H14O2/c17-15(18)16(10-12-6-2-1-3-7-12)11-13-8-4-5-9-14(13)16/h1-9H,10-11H2,(H,17,18)/t16-/m1/s1.
What are the key properties of (7R)-7-benzylbicyclo[4.2.0]octa-1,3,5-triene-7-carboxylic acid?
(7R)-7-benzylbicyclo[4.2.0]octa-1,3,5-triene-7-carboxylic acid has a molecular weight of 238.29 g/mol, XLogP of 2.81, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (7R)-7-benzylbicyclo[4.2.0]octa-1,3,5-triene-7-carboxylic acid is sourced from PubChem (CID 125469336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).