1-but-2-enyl-2,3-dihydroindene-1-carboxylic acid

C14H16O2 — CID 79428785

IUPAC1-but-2-enyl-2,3-dihydroindene-1-carboxylic acid
SMILESCC=CCC1(C(=O)O)CCc2ccccc21
InChIInChI=1S/C14H16O2/c1-2-3-9-14(13(15)16)10-8-11-6-4-5-7-12(11)14/h2-7H,8-10H2,1H3,(H,15,16)
InChIKeyBRQFBXFBCXXJJR-UHFFFAOYSA-N
MW216.28 g/mol
LogP2.92
Rot. Bonds3

About 1-but-2-enyl-2,3-dihydroindene-1-carboxylic acid

1-but-2-enyl-2,3-dihydroindene-1-carboxylic acid (PubChem CID 79428785) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is 1-but-2-enyl-2,3-dihydroindene-1-carboxylic acid.

Molecular Properties

Compound Name1-but-2-enyl-2,3-dihydroindene-1-carboxylic acid
PubChem CID79428785
Molecular FormulaC14H16O2
Molecular Weight216.28 g/mol
Exact Mass216.12
IUPAC Name1-but-2-enyl-2,3-dihydroindene-1-carboxylic acid
SMILESCC=CCC1(C(=O)O)CCc2ccccc21
InChIInChI=1S/C14H16O2/c1-2-3-9-14(13(15)16)10-8-11-6-4-5-7-12(11)14/h2-7H,8-10H2,1H3,(H,15,16)
InChIKeyBRQFBXFBCXXJJR-UHFFFAOYSA-N
XLogP2.92
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.28
LogP ≤ 52.92
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 1-but-2-enyl-2,3-dihydroindene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-but-2-enyl-2,3-dihydroindene-1-carboxylic acid?
The IUPAC name of 1-but-2-enyl-2,3-dihydroindene-1-carboxylic acid (CID 79428785) is 1-but-2-enyl-2,3-dihydroindene-1-carboxylic acid.
What is the SMILES notation for 1-but-2-enyl-2,3-dihydroindene-1-carboxylic acid?
The canonical SMILES for 1-but-2-enyl-2,3-dihydroindene-1-carboxylic acid is CC=CCC1(C(=O)O)CCc2ccccc21.
What is the InChIKey of 1-but-2-enyl-2,3-dihydroindene-1-carboxylic acid?
The InChIKey is BRQFBXFBCXXJJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O2/c1-2-3-9-14(13(15)16)10-8-11-6-4-5-7-12(11)14/h2-7H,8-10H2,1H3,(H,15,16).
What are the key properties of 1-but-2-enyl-2,3-dihydroindene-1-carboxylic acid?
1-but-2-enyl-2,3-dihydroindene-1-carboxylic acid has a molecular weight of 216.28 g/mol, XLogP of 2.92, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-but-2-enyl-2,3-dihydroindene-1-carboxylic acid is sourced from PubChem (CID 79428785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).