C14H19NOSi — CID 11311149
(1R)-1-trimethylsilyloxy-3,4-dihydro-2H-naphthalene-1-carbonitrile (PubChem CID 11311149) has the molecular formula C14H19NOSi and a molecular weight of 245.40 g/mol. Its IUPAC name is (1R)-1-trimethylsilyloxy-3,4-dihydro-2H-naphthalene-1-carbonitrile.
| Compound Name | (1R)-1-trimethylsilyloxy-3,4-dihydro-2H-naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 11311149 |
| Molecular Formula | C14H19NOSi |
| Molecular Weight | 245.40 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | (1R)-1-trimethylsilyloxy-3,4-dihydro-2H-naphthalene-1-carbonitrile |
| SMILES | C[Si](C)(C)O[C@]1(C#N)CCCc2ccccc21 |
| InChI | InChI=1S/C14H19NOSi/c1-17(2,3)16-14(11-15)10-6-8-12-7-4-5-9-13(12)14/h4-5,7,9H,6,8,10H2,1-3H3/t14-/m0/s1 |
| InChIKey | AMMBOYWMOPYMGK-AWEZNQCLSA-N |
| XLogP | 3.59 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|