C15H21NO2Si — CID 124642220
(2R)-5-methoxy-2-trimethylsilyloxy-3,4-dihydro-1H-naphthalene-2-carbonitrile (PubChem CID 124642220) has the molecular formula C15H21NO2Si and a molecular weight of 275.42 g/mol. Its IUPAC name is (2R)-5-methoxy-2-trimethylsilyloxy-3,4-dihydro-1H-naphthalene-2-carbonitrile.
| Compound Name | (2R)-5-methoxy-2-trimethylsilyloxy-3,4-dihydro-1H-naphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 124642220 |
| Molecular Formula | C15H21NO2Si |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | (2R)-5-methoxy-2-trimethylsilyloxy-3,4-dihydro-1H-naphthalene-2-carbonitrile |
| SMILES | COc1cccc2c1CC[C@@](C#N)(O[Si](C)(C)C)C2 |
| InChI | InChI=1S/C15H21NO2Si/c1-17-14-7-5-6-12-10-15(11-16,9-8-13(12)14)18-19(2,3)4/h5-7H,8-10H2,1-4H3/t15-/m1/s1 |
| InChIKey | LLULZWMOXSBBSN-OAHLLOKOSA-N |
| XLogP | 3.30 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|