C15H17NO — CID 11085522
5-ethenyl-5-hydroxy-6-methyl-8,9-dihydro-7H-benzo[7]annulene-6-carbonitrile (PubChem CID 11085522) has the molecular formula C15H17NO and a molecular weight of 227.31 g/mol. Its IUPAC name is 5-ethenyl-5-hydroxy-6-methyl-8,9-dihydro-7H-benzo[7]annulene-6-carbonitrile.
| Compound Name | 5-ethenyl-5-hydroxy-6-methyl-8,9-dihydro-7H-benzo[7]annulene-6-carbonitrile |
|---|---|
| PubChem CID | 11085522 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 5-ethenyl-5-hydroxy-6-methyl-8,9-dihydro-7H-benzo[7]annulene-6-carbonitrile |
| SMILES | C=CC1(O)c2ccccc2CCCC1(C)C#N |
| InChI | InChI=1S/C15H17NO/c1-3-15(17)13-9-5-4-7-12(13)8-6-10-14(15,2)11-16/h3-5,7,9,17H,1,6,8,10H2,2H3 |
| InChIKey | VAUNSDQALDCZHR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|