C13H17NO — CID 70513722
1-(1-aminoprop-2-enyl)-3,4-dihydro-2H-naphthalen-1-ol (PubChem CID 70513722) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is 1-(1-aminoprop-2-enyl)-3,4-dihydro-2H-naphthalen-1-ol.
| Compound Name | 1-(1-aminoprop-2-enyl)-3,4-dihydro-2H-naphthalen-1-ol |
|---|---|
| PubChem CID | 70513722 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 1-(1-aminoprop-2-enyl)-3,4-dihydro-2H-naphthalen-1-ol |
| SMILES | C=CC(N)C1(O)CCCc2ccccc21 |
| InChI | InChI=1S/C13H17NO/c1-2-12(14)13(15)9-5-7-10-6-3-4-8-11(10)13/h2-4,6,8,12,15H,1,5,7,9,14H2 |
| InChIKey | INQQCVRVXPJXGQ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|