C25H30O2Si — CID 24899121
trimethyl-[[(2S,3R,4S,5S)-5-methyl-2-phenyl-4-(2-phenylethynyl)-1-oxaspiro[2.5]octan-4-yl]oxy]silane (PubChem CID 24899121) has the molecular formula C25H30O2Si and a molecular weight of 390.60 g/mol. Its IUPAC name is trimethyl-[[(2S,3R,4S,5S)-5-methyl-2-phenyl-4-(2-phenylethynyl)-1-oxaspiro[2.5]octan-4-yl]oxy]silane.
| Compound Name | trimethyl-[[(2S,3R,4S,5S)-5-methyl-2-phenyl-4-(2-phenylethynyl)-1-oxaspiro[2.5]octan-4-yl]oxy]silane |
|---|---|
| PubChem CID | 24899121 |
| Molecular Formula | C25H30O2Si |
| Molecular Weight | 390.60 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | trimethyl-[[(2S,3R,4S,5S)-5-methyl-2-phenyl-4-(2-phenylethynyl)-1-oxaspiro[2.5]octan-4-yl]oxy]silane |
| SMILES | C[C@H]1CCC[C@]2(O[C@H]2c2ccccc2)[C@]1(C#Cc1ccccc1)O[Si](C)(C)C |
| InChI | InChI=1S/C25H30O2Si/c1-20-12-11-18-25(23(26-25)22-15-9-6-10-16-22)24(20,27-28(2,3)4)19-17-21-13-7-5-8-14-21/h5-10,13-16,20,23H,11-12,18H2,1-4H3/t20-,23-,24+,25+/m0/s1 |
| InChIKey | VCMAMLLWYLKFMF-MNPDLOSFSA-N |
| XLogP | 5.96 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.60 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|