C15H18O3 — CID 7559548
(2R,5S,7S)-7-methyl-2-phenyl-1,4-dioxaspiro[4.5]decan-3-one (PubChem CID 7559548) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is (2R,5S,7S)-7-methyl-2-phenyl-1,4-dioxaspiro[4.5]decan-3-one.
| Compound Name | (2R,5S,7S)-7-methyl-2-phenyl-1,4-dioxaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 7559548 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | (2R,5S,7S)-7-methyl-2-phenyl-1,4-dioxaspiro[4.5]decan-3-one |
| SMILES | C[C@H]1CCC[C@@]2(C1)OC(=O)[C@@H](c1ccccc1)O2 |
| InChI | InChI=1S/C15H18O3/c1-11-6-5-9-15(10-11)17-13(14(16)18-15)12-7-3-2-4-8-12/h2-4,7-8,11,13H,5-6,9-10H2,1H3/t11-,13+,15-/m0/s1 |
| InChIKey | AHZFQHGOXINGBX-LNSITVRQSA-N |
| XLogP | 3.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |