C16H16O5S — CID 11461357
(5R,6S,9R)-4,4-dioxo-9-phenyl-7,10-dioxa-4λ6-thiadispiro[4.0.46.35]tridec-1-en-8-one (PubChem CID 11461357) has the molecular formula C16H16O5S and a molecular weight of 320.37 g/mol. Its IUPAC name is (5R,6S,9R)-4,4-dioxo-9-phenyl-7,10-dioxa-4λ6-thiadispiro[4.0.46.35]tridec-1-en-8-one.
| Compound Name | (5R,6S,9R)-4,4-dioxo-9-phenyl-7,10-dioxa-4λ6-thiadispiro[4.0.46.35]tridec-1-en-8-one |
|---|---|
| PubChem CID | 11461357 |
| Molecular Formula | C16H16O5S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | (5R,6S,9R)-4,4-dioxo-9-phenyl-7,10-dioxa-4λ6-thiadispiro[4.0.46.35]tridec-1-en-8-one |
| SMILES | O=C1O[C@]2(CCC[C@@]23C=CCS3(=O)=O)O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H16O5S/c17-14-13(12-6-2-1-3-7-12)20-16(21-14)10-4-8-15(16)9-5-11-22(15,18)19/h1-3,5-7,9,13H,4,8,10-11H2/t13-,15-,16+/m1/s1 |
| InChIKey | YLLZQKJRUHUBOI-BMFZPTHFSA-N |
| XLogP | 1.90 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|