C12H14N2O3S — CID 10754228
7-amino-4,4-dioxo-6-phenyl-4lambda6-thia-7-azaspiro[2.5]octan-8-one (PubChem CID 10754228) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is 7-amino-4,4-dioxo-6-phenyl-4lambda6-thia-7-azaspiro[2.5]octan-8-one.
| Compound Name | 7-amino-4,4-dioxo-6-phenyl-4lambda6-thia-7-azaspiro[2.5]octan-8-one |
|---|---|
| PubChem CID | 10754228 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 7-amino-4,4-dioxo-6-phenyl-4lambda6-thia-7-azaspiro[2.5]octan-8-one |
| SMILES | NN1C(=O)C2(CC2)S(=O)(=O)CC1c1ccccc1 |
| InChI | InChI=1S/C12H14N2O3S/c13-14-10(9-4-2-1-3-5-9)8-18(16,17)12(6-7-12)11(14)15/h1-5,10H,6-8,13H2 |
| InChIKey | MGXLSEQGLMBZMO-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|