C12H15NO2S — CID 155487624
6-phenyl-5λ6-thia-4-azaspiro[2.5]octane 5,5-dioxide (PubChem CID 155487624) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is 6-phenyl-5λ6-thia-4-azaspiro[2.5]octane 5,5-dioxide.
| Compound Name | 6-phenyl-5λ6-thia-4-azaspiro[2.5]octane 5,5-dioxide |
|---|---|
| PubChem CID | 155487624 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 6-phenyl-5λ6-thia-4-azaspiro[2.5]octane 5,5-dioxide |
| SMILES | O=S1(=O)NC2(CCC1c1ccccc1)CC2 |
| InChI | InChI=1S/C12H15NO2S/c14-16(15)11(10-4-2-1-3-5-10)6-7-12(13-16)8-9-12/h1-5,11,13H,6-9H2 |
| InChIKey | RCPSXSWECOGTHX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |