C14H14N2O2S — CID 95561844
(3S,4R)-3,4-diphenyl-1,2,5-thiadiazolidine 1,1-dioxide (PubChem CID 95561844) has the molecular formula C14H14N2O2S and a molecular weight of 274.35 g/mol. Its IUPAC name is (3S,4R)-3,4-diphenyl-1,2,5-thiadiazolidine 1,1-dioxide.
| Compound Name | (3S,4R)-3,4-diphenyl-1,2,5-thiadiazolidine 1,1-dioxide |
|---|---|
| PubChem CID | 95561844 |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | (3S,4R)-3,4-diphenyl-1,2,5-thiadiazolidine 1,1-dioxide |
| SMILES | O=S1(=O)N[C@H](c2ccccc2)[C@H](c2ccccc2)N1 |
| InChI | InChI=1S/C14H14N2O2S/c17-19(18)15-13(11-7-3-1-4-8-11)14(16-19)12-9-5-2-6-10-12/h1-10,13-16H/t13-,14+ |
| InChIKey | CQFMYKOPDSGUGD-OKILXGFUSA-N |
| XLogP | 1.91 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |