C9H8FNO — CID 101430981
(3S,4S)-3-fluoro-4-phenylazetidin-2-one (PubChem CID 101430981) has the molecular formula C9H8FNO and a molecular weight of 165.17 g/mol. Its IUPAC name is (3S,4S)-3-fluoro-4-phenylazetidin-2-one.
| Compound Name | (3S,4S)-3-fluoro-4-phenylazetidin-2-one |
|---|---|
| PubChem CID | 101430981 |
| Molecular Formula | C9H8FNO |
| Molecular Weight | 165.17 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | (3S,4S)-3-fluoro-4-phenylazetidin-2-one |
| SMILES | O=C1N[C@@H](c2ccccc2)[C@@H]1F |
| InChI | InChI=1S/C9H8FNO/c10-7-8(11-9(7)12)6-4-2-1-3-5-6/h1-5,7-8H,(H,11,12)/t7-,8-/m0/s1 |
| InChIKey | YIWIHTWNUFNIPO-YUMQZZPRSA-N |
| XLogP | 1.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.17 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |