C9H10FN — CID 118903296
(2S,3S)-3-fluoro-2-phenylazetidine (PubChem CID 118903296) has the molecular formula C9H10FN and a molecular weight of 151.18 g/mol. Its IUPAC name is (2S,3S)-3-fluoro-2-phenylazetidine.
| Compound Name | (2S,3S)-3-fluoro-2-phenylazetidine |
|---|---|
| PubChem CID | 118903296 |
| Molecular Formula | C9H10FN |
| Molecular Weight | 151.18 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | (2S,3S)-3-fluoro-2-phenylazetidine |
| SMILES | F[C@H]1CN[C@H]1c1ccccc1 |
| InChI | InChI=1S/C9H10FN/c10-8-6-11-9(8)7-4-2-1-3-5-7/h1-5,8-9,11H,6H2/t8-,9-/m0/s1 |
| InChIKey | ZAPFREAVHLJWSV-IUCAKERBSA-N |
| XLogP | 1.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.18 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |