C23H22O2S — CID 15620369
2,4,6-triphenylthiane 1,1-dioxide (PubChem CID 15620369) has the molecular formula C23H22O2S and a molecular weight of 362.49 g/mol. Its IUPAC name is 2,4,6-triphenylthiane 1,1-dioxide.
| Compound Name | 2,4,6-triphenylthiane 1,1-dioxide |
|---|---|
| PubChem CID | 15620369 |
| Molecular Formula | C23H22O2S |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 2,4,6-triphenylthiane 1,1-dioxide |
| SMILES | O=S1(=O)C(c2ccccc2)CC(c2ccccc2)CC1c1ccccc1 |
| InChI | InChI=1S/C23H22O2S/c24-26(25)22(19-12-6-2-7-13-19)16-21(18-10-4-1-5-11-18)17-23(26)20-14-8-3-9-15-20/h1-15,21-23H,16-17H2 |
| InChIKey | LGWKWEBJSHQTRF-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |