C14H19NO — CID 166834731
2-methyl-N-(3-phenylcyclobutyl)propanamide (PubChem CID 166834731) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 2-methyl-N-(3-phenylcyclobutyl)propanamide.
| Compound Name | 2-methyl-N-(3-phenylcyclobutyl)propanamide |
|---|---|
| PubChem CID | 166834731 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 2-methyl-N-(3-phenylcyclobutyl)propanamide |
| SMILES | CC(C)C(=O)NC1CC(c2ccccc2)C1 |
| InChI | InChI=1S/C14H19NO/c1-10(2)14(16)15-13-8-12(9-13)11-6-4-3-5-7-11/h3-7,10,12-13H,8-9H2,1-2H3,(H,15,16) |
| InChIKey | CMOLNKGESMCZDX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |