C33H33N2+ — CID 87496129
(2R,5R)-1-[(2,5-diphenylpyrrolidin-1-ium-1-ylidene)methyl]-2,5-diphenylpyrrolidine (PubChem CID 87496129) has the molecular formula C33H33N2+ and a molecular weight of 457.64 g/mol. Its IUPAC name is (2R,5R)-1-[(2,5-diphenylpyrrolidin-1-ium-1-ylidene)methyl]-2,5-diphenylpyrrolidine.
| Compound Name | (2R,5R)-1-[(2,5-diphenylpyrrolidin-1-ium-1-ylidene)methyl]-2,5-diphenylpyrrolidine |
|---|---|
| PubChem CID | 87496129 |
| Molecular Formula | C33H33N2+ |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | (2R,5R)-1-[(2,5-diphenylpyrrolidin-1-ium-1-ylidene)methyl]-2,5-diphenylpyrrolidine |
| SMILES | C(N1[C@@H](c2ccccc2)CC[C@@H]1c1ccccc1)=[N+]1C(c2ccccc2)CCC1c1ccccc1 |
| InChI | InChI=1S/C33H33N2/c1-5-13-26(14-6-1)30-21-22-31(27-15-7-2-8-16-27)34(30)25-35-32(28-17-9-3-10-18-28)23-24-33(35)29-19-11-4-12-20-29/h1-20,25,30-33H,21-24H2/q+1/t30-,31-,32?,33?/m1/s1 |
| InChIKey | RKWMIVFPGFFTSZ-AOQDKHGRSA-N |
| XLogP | 7.88 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|