C14H14O2 — CID 101451441
2-(2-phenylethynyl)-7-oxabicyclo[4.1.0]heptan-2-ol (PubChem CID 101451441) has the molecular formula C14H14O2 and a molecular weight of 214.26 g/mol. Its IUPAC name is 2-(2-phenylethynyl)-7-oxabicyclo[4.1.0]heptan-2-ol.
| Compound Name | 2-(2-phenylethynyl)-7-oxabicyclo[4.1.0]heptan-2-ol |
|---|---|
| PubChem CID | 101451441 |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 2-(2-phenylethynyl)-7-oxabicyclo[4.1.0]heptan-2-ol |
| SMILES | OC1(C#Cc2ccccc2)CCCC2OC21 |
| InChI | InChI=1S/C14H14O2/c15-14(9-4-7-12-13(14)16-12)10-8-11-5-2-1-3-6-11/h1-3,5-6,12-13,15H,4,7,9H2 |
| InChIKey | VHRBRKVYIDNBNE-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|