C20H25NO3 — CID 86597288
ethyl 5-hydroxy-5-(2-phenylethynyl)-2,3,4,4a,6,7,8,8a-octahydroquinoline-1-carboxylate (PubChem CID 86597288) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is ethyl 5-hydroxy-5-(2-phenylethynyl)-2,3,4,4a,6,7,8,8a-octahydroquinoline-1-carboxylate.
| Compound Name | ethyl 5-hydroxy-5-(2-phenylethynyl)-2,3,4,4a,6,7,8,8a-octahydroquinoline-1-carboxylate |
|---|---|
| PubChem CID | 86597288 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | ethyl 5-hydroxy-5-(2-phenylethynyl)-2,3,4,4a,6,7,8,8a-octahydroquinoline-1-carboxylate |
| SMILES | CCOC(=O)N1CCCC2C1CCCC2(O)C#Cc1ccccc1 |
| InChI | InChI=1S/C20H25NO3/c1-2-24-19(22)21-15-7-10-17-18(21)11-6-13-20(17,23)14-12-16-8-4-3-5-9-16/h3-5,8-9,17-18,23H,2,6-7,10-11,13,15H2,1H3 |
| InChIKey | WIPRRMYYUMAMPJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|