C19H22ClNO3 — CID 25258982
ethyl (3aR,4S,7aR)-4-[2-(3-chlorophenyl)ethynyl]-4-hydroxy-3,3a,5,6,7,7a-hexahydro-2H-indole-1-carboxylate (PubChem CID 25258982) has the molecular formula C19H22ClNO3 and a molecular weight of 347.84 g/mol. Its IUPAC name is ethyl (3aR,4S,7aR)-4-[2-(3-chlorophenyl)ethynyl]-4-hydroxy-3,3a,5,6,7,7a-hexahydro-2H-indole-1-carboxylate.
| Compound Name | ethyl (3aR,4S,7aR)-4-[2-(3-chlorophenyl)ethynyl]-4-hydroxy-3,3a,5,6,7,7a-hexahydro-2H-indole-1-carboxylate |
|---|---|
| PubChem CID | 25258982 |
| Molecular Formula | C19H22ClNO3 |
| Molecular Weight | 347.84 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | ethyl (3aR,4S,7aR)-4-[2-(3-chlorophenyl)ethynyl]-4-hydroxy-3,3a,5,6,7,7a-hexahydro-2H-indole-1-carboxylate |
| SMILES | CCOC(=O)N1CC[C@@H]2[C@H]1CCC[C@@]2(O)C#Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H22ClNO3/c1-2-24-18(22)21-12-9-16-17(21)7-4-10-19(16,23)11-8-14-5-3-6-15(20)13-14/h3,5-6,13,16-17,23H,2,4,7,9-10,12H2,1H3/t16-,17-,19-/m1/s1 |
| InChIKey | FEYFOLRTFYMDRW-ZHALLVOQSA-N |
| XLogP | 3.45 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.84 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|