C22H26ClNO3 — CID 25261891
tert-butyl (5S)-5-[2-(3-chlorophenyl)ethynyl]-5-hydroxy-2,3,4,4a,6,7-hexahydroquinoline-1-carboxylate (PubChem CID 25261891) has the molecular formula C22H26ClNO3 and a molecular weight of 387.91 g/mol. Its IUPAC name is tert-butyl (5S)-5-[2-(3-chlorophenyl)ethynyl]-5-hydroxy-2,3,4,4a,6,7-hexahydroquinoline-1-carboxylate.
| Compound Name | tert-butyl (5S)-5-[2-(3-chlorophenyl)ethynyl]-5-hydroxy-2,3,4,4a,6,7-hexahydroquinoline-1-carboxylate |
|---|---|
| PubChem CID | 25261891 |
| Molecular Formula | C22H26ClNO3 |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | tert-butyl (5S)-5-[2-(3-chlorophenyl)ethynyl]-5-hydroxy-2,3,4,4a,6,7-hexahydroquinoline-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC2C1=CCC[C@@]2(O)C#Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H26ClNO3/c1-21(2,3)27-20(25)24-14-6-9-18-19(24)10-5-12-22(18,26)13-11-16-7-4-8-17(23)15-16/h4,7-8,10,15,18,26H,5-6,9,12,14H2,1-3H3/t18?,22-/m1/s1 |
| InChIKey | XHEBUYKCZFYTGT-LMNIDFBRSA-N |
| XLogP | 4.75 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|