C21H20ClNO3 — CID 69316749
[3-[2-(3-chlorophenyl)ethynyl]-3-hydroxypiperidin-1-yl]-(2-hydroxy-5-methylphenyl)methanone (PubChem CID 69316749) has the molecular formula C21H20ClNO3 and a molecular weight of 369.85 g/mol. Its IUPAC name is [3-[2-(3-chlorophenyl)ethynyl]-3-hydroxypiperidin-1-yl]-(2-hydroxy-5-methylphenyl)methanone.
| Compound Name | [3-[2-(3-chlorophenyl)ethynyl]-3-hydroxypiperidin-1-yl]-(2-hydroxy-5-methylphenyl)methanone |
|---|---|
| PubChem CID | 69316749 |
| Molecular Formula | C21H20ClNO3 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | [3-[2-(3-chlorophenyl)ethynyl]-3-hydroxypiperidin-1-yl]-(2-hydroxy-5-methylphenyl)methanone |
| SMILES | Cc1ccc(O)c(C(=O)N2CCCC(O)(C#Cc3cccc(Cl)c3)C2)c1 |
| InChI | InChI=1S/C21H20ClNO3/c1-15-6-7-19(24)18(12-15)20(25)23-11-3-9-21(26,14-23)10-8-16-4-2-5-17(22)13-16/h2,4-7,12-13,24,26H,3,9,11,14H2,1H3 |
| InChIKey | XMSVCUTWAHJIRG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|