C17H14ClNO3 — CID 69318133
[3-[2-(3-chlorophenyl)ethynyl]-3-hydroxypyrrolidin-1-yl]-(furan-2-yl)methanone (PubChem CID 69318133) has the molecular formula C17H14ClNO3 and a molecular weight of 315.76 g/mol. Its IUPAC name is [3-[2-(3-chlorophenyl)ethynyl]-3-hydroxypyrrolidin-1-yl]-(furan-2-yl)methanone.
| Compound Name | [3-[2-(3-chlorophenyl)ethynyl]-3-hydroxypyrrolidin-1-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 69318133 |
| Molecular Formula | C17H14ClNO3 |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | [3-[2-(3-chlorophenyl)ethynyl]-3-hydroxypyrrolidin-1-yl]-(furan-2-yl)methanone |
| SMILES | O=C(c1ccco1)N1CCC(O)(C#Cc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C17H14ClNO3/c18-14-4-1-3-13(11-14)6-7-17(21)8-9-19(12-17)16(20)15-5-2-10-22-15/h1-5,10-11,21H,8-9,12H2 |
| InChIKey | DLEMQQPMBHFBHI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|