C22H22ClNO4 — CID 69317019
[3-[2-(3-chlorophenyl)ethynyl]-3-hydroxypiperidin-1-yl]-(2,3-dimethoxyphenyl)methanone (PubChem CID 69317019) has the molecular formula C22H22ClNO4 and a molecular weight of 399.87 g/mol. Its IUPAC name is [3-[2-(3-chlorophenyl)ethynyl]-3-hydroxypiperidin-1-yl]-(2,3-dimethoxyphenyl)methanone.
| Compound Name | [3-[2-(3-chlorophenyl)ethynyl]-3-hydroxypiperidin-1-yl]-(2,3-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 69317019 |
| Molecular Formula | C22H22ClNO4 |
| Molecular Weight | 399.87 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | [3-[2-(3-chlorophenyl)ethynyl]-3-hydroxypiperidin-1-yl]-(2,3-dimethoxyphenyl)methanone |
| SMILES | COc1cccc(C(=O)N2CCCC(O)(C#Cc3cccc(Cl)c3)C2)c1OC |
| InChI | InChI=1S/C22H22ClNO4/c1-27-19-9-4-8-18(20(19)28-2)21(25)24-13-5-11-22(26,15-24)12-10-16-6-3-7-17(23)14-16/h3-4,6-9,14,26H,5,11,13,15H2,1-2H3 |
| InChIKey | VOPVOGXIFREZIS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.87 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|