C21H23NO5 — CID 45433253
1-(2,3-dimethoxybenzoyl)-4-phenylpiperidine-4-carboxylic acid (PubChem CID 45433253) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is 1-(2,3-dimethoxybenzoyl)-4-phenylpiperidine-4-carboxylic acid.
| Compound Name | 1-(2,3-dimethoxybenzoyl)-4-phenylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 45433253 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 1-(2,3-dimethoxybenzoyl)-4-phenylpiperidine-4-carboxylic acid |
| SMILES | COc1cccc(C(=O)N2CCC(C(=O)O)(c3ccccc3)CC2)c1OC |
| InChI | InChI=1S/C21H23NO5/c1-26-17-10-6-9-16(18(17)27-2)19(23)22-13-11-21(12-14-22,20(24)25)15-7-4-3-5-8-15/h3-10H,11-14H2,1-2H3,(H,24,25) |
| InChIKey | JBLFEGKGWCSLCZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |