C27H27FN2O3 — CID 23600304
1-(2-fluorobenzoyl)-N-[(2-methoxyphenyl)methyl]-4-phenylpiperidine-4-carboxamide (PubChem CID 23600304) has the molecular formula C27H27FN2O3 and a molecular weight of 446.52 g/mol. Its IUPAC name is 1-(2-fluorobenzoyl)-N-[(2-methoxyphenyl)methyl]-4-phenylpiperidine-4-carboxamide.
| Compound Name | 1-(2-fluorobenzoyl)-N-[(2-methoxyphenyl)methyl]-4-phenylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 23600304 |
| Molecular Formula | C27H27FN2O3 |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 1-(2-fluorobenzoyl)-N-[(2-methoxyphenyl)methyl]-4-phenylpiperidine-4-carboxamide |
| SMILES | COc1ccccc1CNC(=O)C1(c2ccccc2)CCN(C(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C27H27FN2O3/c1-33-24-14-8-5-9-20(24)19-29-26(32)27(21-10-3-2-4-11-21)15-17-30(18-16-27)25(31)22-12-6-7-13-23(22)28/h2-14H,15-19H2,1H3,(H,29,32) |
| InChIKey | CGKYGDHGJIAZOL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |