C20H20N2O6 — CID 45338263
1-(2-methoxy-5-nitrobenzoyl)-4-phenylpiperidine-4-carboxylic acid (PubChem CID 45338263) has the molecular formula C20H20N2O6 and a molecular weight of 384.39 g/mol. Its IUPAC name is 1-(2-methoxy-5-nitrobenzoyl)-4-phenylpiperidine-4-carboxylic acid.
| Compound Name | 1-(2-methoxy-5-nitrobenzoyl)-4-phenylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 45338263 |
| Molecular Formula | C20H20N2O6 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 1-(2-methoxy-5-nitrobenzoyl)-4-phenylpiperidine-4-carboxylic acid |
| SMILES | COc1ccc([N+](=O)[O-])cc1C(=O)N1CCC(C(=O)O)(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H20N2O6/c1-28-17-8-7-15(22(26)27)13-16(17)18(23)21-11-9-20(10-12-21,19(24)25)14-5-3-2-4-6-14/h2-8,13H,9-12H2,1H3,(H,24,25) |
| InChIKey | PNWGVUNQWCGGHF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|